Products 2306247-79-8
CAS 2306247-79-8 is the registry number for (1R,4R)-5,5-difluoro-2-azabicyclo[2.2.1]heptane hydrochloride. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
(1R,4R)-5,5-difluoro-2-azabicyclo[2.2.1]heptane;hydrochloride (CAS 2306247-79-8) is a chemical compound with the molecular formula C6H10ClF2N and a molecular weight of 169.60 g/mol. IUPAC name: (1R,4R)-5,5-difluoro-2-azabicyclo[2.2.1]heptane;hydrochloride. InChIKey: QMDZLCXWXXBOKU-TYSVMGFPSA-N.
| Molecular formula | C6H10ClF2N |
|---|---|
| Molecular weight | 169.60 g/mol |
| IUPAC name | (1R,4R)-5,5-difluoro-2-azabicyclo[2.2.1]heptane;hydrochloride |
| InChIKey | QMDZLCXWXXBOKU-TYSVMGFPSA-N |
| SMILES | C1[C@@H]2CC([C@H]1CN2)(F)F.Cl |
Computed by PubChem (NCBI)