Products 2306249-28-3
CAS 2306249-28-3 is the registry number for (1R,2S,5S)-8-Azabicyclo(3.2.1)octan-2-ol hydrochloride, 98%. Offered by: AmBeed. Available pack sizes: 1g, 250mg.
(1R,2S,5S)-8-azabicyclo[3.2.1]octan-2-ol;hydrochloride (CAS 2306249-28-3) is a chemical compound with the molecular formula C7H14ClNO and a molecular weight of 163.64 g/mol. IUPAC name: (1R,2S,5S)-8-azabicyclo[3.2.1]octan-2-ol;hydrochloride. InChIKey: RGVUEZZFOBZYQJ-UHRUZOLSSA-N.
| Molecular formula | C7H14ClNO |
|---|---|
| Molecular weight | 163.64 g/mol |
| IUPAC name | (1R,2S,5S)-8-azabicyclo[3.2.1]octan-2-ol;hydrochloride |
| InChIKey | RGVUEZZFOBZYQJ-UHRUZOLSSA-N |
| SMILES | C1C[C@@H]2[C@H](CC[C@H]1N2)O.Cl |
Computed by PubChem (NCBI)