Products 2306253-89-2
CAS 2306253-89-2 is the registry number for endo-8-azabicyclo[3.2.1]octan-2-ol,hydrochloride, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
(1R,2R,5S)-8-azabicyclo[3.2.1]octan-2-ol;hydrochloride (CAS 2306253-89-2) is a chemical compound with the molecular formula C7H14ClNO and a molecular weight of 163.64 g/mol. IUPAC name: (1R,2R,5S)-8-azabicyclo[3.2.1]octan-2-ol;hydrochloride. InChIKey: RGVUEZZFOBZYQJ-VWZUFWLJSA-N.
| Molecular formula | C7H14ClNO |
|---|---|
| Molecular weight | 163.64 g/mol |
| IUPAC name | (1R,2R,5S)-8-azabicyclo[3.2.1]octan-2-ol;hydrochloride |
| InChIKey | RGVUEZZFOBZYQJ-VWZUFWLJSA-N |
| SMILES | C1C[C@@H]2[C@@H](CC[C@H]1N2)O.Cl |
Computed by PubChem (NCBI)