Products 2306249-71-6
CAS 2306249-71-6 appears in our catalog under these names: (2S)-1-methylpiperazine-2-carboxylic acid,dihydrochloride, 97%, 97%, (2S)-1-METHYLPIPERAZINE-2-CARBOXYLIC ACID DIHYDROCHLORIDE, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 500mg, 1g.
(2S)-1-methylpiperazine-2-carboxylic acid;dihydrochloride (CAS 2306249-71-6) is a chemical compound with the molecular formula C6H14Cl2N2O2 and a molecular weight of 217.09 g/mol. IUPAC name: (2S)-1-methylpiperazine-2-carboxylic acid;dihydrochloride. InChIKey: DSADJSWCEFUWHA-XRIGFGBMSA-N.
| Molecular formula | C6H14Cl2N2O2 |
|---|---|
| Molecular weight | 217.09 g/mol |
| IUPAC name | (2S)-1-methylpiperazine-2-carboxylic acid;dihydrochloride |
| InChIKey | DSADJSWCEFUWHA-XRIGFGBMSA-N |
| SMILES | CN1CCNC[C@H]1C(=O)O.Cl.Cl |
Computed by PubChem (NCBI)