Products 2306253-35-8
CAS 2306253-35-8 is the registry number for (1S,6R)-8-Methyl-3,8-diazabicyclo[4.2.0]octane hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1S,6R)-8-methyl-3,8-diazabicyclo[4.2.0]octane;hydrochloride (CAS 2306253-35-8) is a chemical compound with the molecular formula C7H15ClN2 and a molecular weight of 162.66 g/mol. IUPAC name: (1S,6R)-8-methyl-3,8-diazabicyclo[4.2.0]octane;hydrochloride. InChIKey: AOZFKNMFKSLKRF-ZJLYAJKPSA-N.
| Molecular formula | C7H15ClN2 |
|---|---|
| Molecular weight | 162.66 g/mol |
| IUPAC name | (1S,6R)-8-methyl-3,8-diazabicyclo[4.2.0]octane;hydrochloride |
| InChIKey | AOZFKNMFKSLKRF-ZJLYAJKPSA-N |
| SMILES | CN1C[C@@H]2[C@H]1CNCC2.Cl |
Computed by PubChem (NCBI)