Products 25488-15-7

CAS 25488-15-7 is the registry number for 1-Methyl-1,4-diazabicyclo[2.2.2]octan-1-ium chloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

1-methyl-4-aza-1-azoniabicyclo[2.2.2]octane chloride (CAS 25488-15-7) is a chemical compound with the molecular formula C7H15ClN2 and a molecular weight of 162.66 g/mol. IUPAC name: 1-methyl-4-aza-1-azoniabicyclo[2.2.2]octane chloride. InChIKey: FWQAFHOFKMHWSI-UHFFFAOYSA-M.

Identity
Molecular formulaC7H15ClN2
Molecular weight162.66 g/mol
IUPAC name1-methyl-4-aza-1-azoniabicyclo[2.2.2]octane chloride
InChIKeyFWQAFHOFKMHWSI-UHFFFAOYSA-M
SMILESC[N+]12CCN(CC1)CC2.[Cl-]

Computed by PubChem (NCBI)