Products 2306255-34-3
CAS 2306255-34-3 is the registry number for (S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(1-methyl-1H-indol-7-yl)propanoic acid, 94%, 94%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(1-methylindol-7-yl)propanoic acid (CAS 2306255-34-3) is a chemical compound with the molecular formula C27H24N2O4 and a molecular weight of 440.5 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(1-methylindol-7-yl)propanoic acid. InChIKey: LKFQANMXTOAOAB-DEOSSOPVSA-N.
| Molecular formula | C27H24N2O4 |
|---|---|
| Molecular weight | 440.5 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(1-methylindol-7-yl)propanoic acid |
| InChIKey | LKFQANMXTOAOAB-DEOSSOPVSA-N |
| SMILES | CN1C=CC2=C1C(=CC=C2)C[C@@H](C(=O)O)NC(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35 |
Computed by PubChem (NCBI)