CAS 2306261-93-6 is the registry number for 4-Methyl-4-phenylpiperidine-2-carboxylic acid hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-methyl-4-phenylpiperidine-2-carboxylic acid;hydrochloride (CAS 2306261-93-6) is a chemical compound with the molecular formula C13H18ClNO2 and a molecular weight of 255.74 g/mol. IUPAC name: 4-methyl-4-phenylpiperidine-2-carboxylic acid;hydrochloride. InChIKey: CFVKDCQIWNYLCB-UHFFFAOYSA-N.
| Molecular formula | C13H18ClNO2 |
|---|---|
| Molecular weight | 255.74 g/mol |
| IUPAC name | 4-methyl-4-phenylpiperidine-2-carboxylic acid;hydrochloride |
| InChIKey | CFVKDCQIWNYLCB-UHFFFAOYSA-N |
| SMILES | CC1(CCNC(C1)C(=O)O)C2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)