Products 2306261-93-6

CAS 2306261-93-6 is the registry number for 4-Methyl-4-phenylpiperidine-2-carboxylic acid hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

4-methyl-4-phenylpiperidine-2-carboxylic acid;hydrochloride (CAS 2306261-93-6) is a chemical compound with the molecular formula C13H18ClNO2 and a molecular weight of 255.74 g/mol. IUPAC name: 4-methyl-4-phenylpiperidine-2-carboxylic acid;hydrochloride. InChIKey: CFVKDCQIWNYLCB-UHFFFAOYSA-N.

Identity
Molecular formulaC13H18ClNO2
Molecular weight255.74 g/mol
IUPAC name4-methyl-4-phenylpiperidine-2-carboxylic acid;hydrochloride
InChIKeyCFVKDCQIWNYLCB-UHFFFAOYSA-N
SMILESCC1(CCNC(C1)C(=O)O)C2=CC=CC=C2.Cl

Computed by PubChem (NCBI)