CAS 2306263-84-1 is the registry number for 1-[(2,4-Dimethoxyphenyl)methyl]-7-fluoro-indoline-2-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
1-[(2,4-dimethoxyphenyl)methyl]-7-fluoro-2,3-dihydroindole-2-carboxylic acid (CAS 2306263-84-1) is a chemical compound with the molecular formula C18H18FNO4 and a molecular weight of 331.3 g/mol. IUPAC name: 1-[(2,4-dimethoxyphenyl)methyl]-7-fluoro-2,3-dihydroindole-2-carboxylic acid. InChIKey: UYUIFJDNUXRDJU-UHFFFAOYSA-N.
| Molecular formula | C18H18FNO4 |
|---|---|
| Molecular weight | 331.3 g/mol |
| IUPAC name | 1-[(2,4-dimethoxyphenyl)methyl]-7-fluoro-2,3-dihydroindole-2-carboxylic acid |
| InChIKey | UYUIFJDNUXRDJU-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)CN2C(CC3=C2C(=CC=C3)F)C(=O)O)OC |
Computed by PubChem (NCBI)