Products 2923493-61-0
CAS 2923493-61-0 is the registry number for Prasugrel Carboxyenone Impurity. Offered by: TRC. Available pack sizes: 50mg.
(2Z)-2-[1-[2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]-4-oxopiperidin-3-ylidene]acetic acid (CAS 2923493-61-0) is a chemical compound with the molecular formula C18H18FNO4 and a molecular weight of 331.3 g/mol. IUPAC name: (2Z)-2-[1-[2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]-4-oxopiperidin-3-ylidene]acetic acid. InChIKey: SJWHMQBZYXSYLW-XFXZXTDPSA-N.
| Molecular formula | C18H18FNO4 |
|---|---|
| Molecular weight | 331.3 g/mol |
| IUPAC name | (2Z)-2-[1-[2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]-4-oxopiperidin-3-ylidene]acetic acid |
| InChIKey | SJWHMQBZYXSYLW-XFXZXTDPSA-N |
| SMILES | C1CC1C(=O)C(C2=CC=CC=C2F)N3CCC(=O)/C(=C\C(=O)O)/C3 |
Computed by PubChem (NCBI)
Synonyms:
Prasugrel Carboxyenone Impurity