Products 2306270-21-1
CAS 2306270-21-1 appears in our catalog under these names: 3-(4-Fluorophenyl)bicyclo[1.1.1]pentan-1-amine hydrochloride, 97%, 97%, 3-(4-Fluorophenyl)bicyclo[1.1.1]pentan-1-amine hydrochloride, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 500mg.
3-(4-fluorophenyl)bicyclo[1.1.1]pentan-1-amine;hydrochloride (CAS 2306270-21-1) is a chemical compound with the molecular formula C11H13ClFN and a molecular weight of 213.68 g/mol. IUPAC name: 3-(4-fluorophenyl)bicyclo[1.1.1]pentan-1-amine;hydrochloride. InChIKey: HJPFAKPNPWLEEA-UHFFFAOYSA-N.
| Molecular formula | C11H13ClFN |
|---|---|
| Molecular weight | 213.68 g/mol |
| IUPAC name | 3-(4-fluorophenyl)bicyclo[1.1.1]pentan-1-amine;hydrochloride |
| InChIKey | HJPFAKPNPWLEEA-UHFFFAOYSA-N |
| SMILES | C1C2(CC1(C2)N)C3=CC=C(C=C3)F.Cl |
Computed by PubChem (NCBI)