CAS 2306278-16-8 appears in our catalog under these names: 5-Methoxy-6,7-dinitro-indoline, 95%, 5-Methoxy-6,7-dinitro-indoline, 97%, 5-Methoxy-6,7-dinitro-indoline, 97%, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g, 100mg, 500mg.
5-methoxy-6,7-dinitro-2,3-dihydro-1H-indole (CAS 2306278-16-8) is a chemical compound with the molecular formula C9H9N3O5 and a molecular weight of 239.18 g/mol. IUPAC name: 5-methoxy-6,7-dinitro-2,3-dihydro-1H-indole. InChIKey: PPBGKVWNXFMJAS-UHFFFAOYSA-N.
| Molecular formula | C9H9N3O5 |
|---|---|
| Molecular weight | 239.18 g/mol |
| IUPAC name | 5-methoxy-6,7-dinitro-2,3-dihydro-1H-indole |
| InChIKey | PPBGKVWNXFMJAS-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C2C(=C1)CCN2)[N+](=O)[O-])[N+](=O)[O-] |
Computed by PubChem (NCBI)