CAS 681466-46-6 appears in our catalog under these names: 3-(2,4-Dinitrophenyl)propanamide, 95%, 3-(2,4-Dinitrophenyl)propanamide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
3-(2,4-dinitrophenyl)propanamide (CAS 681466-46-6) is a chemical compound with the molecular formula C9H9N3O5 and a molecular weight of 239.18 g/mol. IUPAC name: 3-(2,4-dinitrophenyl)propanamide. InChIKey: QMHIOEYRHBAHBW-UHFFFAOYSA-N.
| Molecular formula | C9H9N3O5 |
|---|---|
| Molecular weight | 239.18 g/mol |
| IUPAC name | 3-(2,4-dinitrophenyl)propanamide |
| InChIKey | QMHIOEYRHBAHBW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])[N+](=O)[O-])CCC(=O)N |
Computed by PubChem (NCBI)