CAS 230643-52-4 appears in our catalog under these names: (R)-2-Amino-N,N-dimethyl-3-phenylpropanamide, 98%, (2R)-2-Amino-N,N-dimethyl-3-phenylpropanamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.
(2R)-2-amino-N,N-dimethyl-3-phenylpropanamide (CAS 230643-52-4) is a chemical compound with the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. IUPAC name: (2R)-2-amino-N,N-dimethyl-3-phenylpropanamide. InChIKey: BXCGVAOWUFKCRN-SNVBAGLBSA-N.
| Molecular formula | C11H16N2O |
|---|---|
| Molecular weight | 192.26 g/mol |
| IUPAC name | (2R)-2-amino-N,N-dimethyl-3-phenylpropanamide |
| InChIKey | BXCGVAOWUFKCRN-SNVBAGLBSA-N |
| SMILES | CN(C)C(=O)[C@@H](CC1=CC=CC=C1)N |
Computed by PubChem (NCBI)