CAS 2307778-24-9 is the registry number for Rel-(1R,2R)-2-(trifluoromethyl)cyclobutan-1-amine hydrochloride, 97%. Offered by: AmBeed. Available pack sizes: 250mg.
Trans-(1S,2S)-2-(trifluoromethyl)cyclobutan-1-amine;hydrochloride (CAS 2307778-24-9) is a chemical compound with the molecular formula C5H9ClF3N and a molecular weight of 175.58 g/mol. IUPAC name: trans-(1S,2S)-2-(trifluoromethyl)cyclobutan-1-amine;hydrochloride. InChIKey: YYYMJJAPNAKGEH-MMALYQPHSA-N.
| Molecular formula | C5H9ClF3N |
|---|---|
| Molecular weight | 175.58 g/mol |
| IUPAC name | trans-(1S,2S)-2-(trifluoromethyl)cyclobutan-1-amine;hydrochloride |
| InChIKey | YYYMJJAPNAKGEH-MMALYQPHSA-N |
| SMILES | C1C[C@@H]([C@H]1C(F)(F)F)N.Cl |
Computed by PubChem (NCBI)