CAS 2719923-58-5 is the registry number for rel-(1R,2S)-2-(Trifluoromethyl)cyclobutan-1-amine hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Cis-(1S,2R)-2-(trifluoromethyl)cyclobutan-1-amine;hydrochloride (CAS 2719923-58-5) is a chemical compound with the molecular formula C5H9ClF3N and a molecular weight of 175.58 g/mol. IUPAC name: cis-(1S,2R)-2-(trifluoromethyl)cyclobutan-1-amine;hydrochloride. InChIKey: YYYMJJAPNAKGEH-HJXLNUONSA-N.
| Molecular formula | C5H9ClF3N |
|---|---|
| Molecular weight | 175.58 g/mol |
| IUPAC name | cis-(1S,2R)-2-(trifluoromethyl)cyclobutan-1-amine;hydrochloride |
| InChIKey | YYYMJJAPNAKGEH-HJXLNUONSA-N |
| SMILES | C1C[C@@H]([C@@H]1C(F)(F)F)N.Cl |
Computed by PubChem (NCBI)