CAS 2307780-42-1 is the registry number for Rel-(1R,5R)-1-(difluoromethyl)-3-azabicyclo(3.1.0)hexane hydrochloride, 98%. Offered by: AmBeed. Available pack sizes: 1g.
(1R,5R)-1-(difluoromethyl)-3-azabicyclo[3.1.0]hexane;hydrochloride (CAS 2307780-42-1) is a chemical compound with the molecular formula C6H10ClF2N and a molecular weight of 169.60 g/mol. IUPAC name: (1R,5R)-1-(difluoromethyl)-3-azabicyclo[3.1.0]hexane;hydrochloride. InChIKey: HWDOTXJULJRZBR-DPIOYBAHSA-N.
| Molecular formula | C6H10ClF2N |
|---|---|
| Molecular weight | 169.60 g/mol |
| IUPAC name | (1R,5R)-1-(difluoromethyl)-3-azabicyclo[3.1.0]hexane;hydrochloride |
| InChIKey | HWDOTXJULJRZBR-DPIOYBAHSA-N |
| SMILES | C1[C@@H]2[C@]1(CNC2)C(F)F.Cl |
Computed by PubChem (NCBI)