Products 2309010-25-9
CAS 2309010-25-9 is the registry number for Moclobemide-d8. Offered by: MedChemExpress. Available pack sizes: 1 mg.
4-chloro-N-[2-(2,2,3,3,5,5,6,6-octadeuteriomorpholin-4-yl)ethyl]benzamide (CAS 2309010-25-9) is a chemical compound with the molecular formula C13H17ClN2O2 and a molecular weight of 276.79 g/mol. IUPAC name: 4-chloro-N-[2-(2,2,3,3,5,5,6,6-octadeuteriomorpholin-4-yl)ethyl]benzamide. InChIKey: YHXISWVBGDMDLQ-UFBJYANTSA-N.
| Molecular formula | C13H17ClN2O2 |
|---|---|
| Molecular weight | 276.79 g/mol |
| IUPAC name | 4-chloro-N-[2-(2,2,3,3,5,5,6,6-octadeuteriomorpholin-4-yl)ethyl]benzamide |
| InChIKey | YHXISWVBGDMDLQ-UFBJYANTSA-N |
| SMILES | [2H]C1(C(OC(C(N1CCNC(=O)C2=CC=C(C=C2)Cl)([2H])[2H])([2H])[2H])([2H])[2H])[2H] |
Computed by PubChem (NCBI)
Synonyms:
Moclobemide-d8, orb2300115