CAS 2309431-62-5 is the registry number for (1S)-1-(3,3-Difluorocyclobutyl)ethan-1-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(1S)-1-(3,3-difluorocyclobutyl)ethanamine;hydrochloride (CAS 2309431-62-5) is a chemical compound with the molecular formula C6H12ClF2N and a molecular weight of 171.61 g/mol. IUPAC name: (1S)-1-(3,3-difluorocyclobutyl)ethanamine;hydrochloride. InChIKey: XYOIKVIEECCBCN-WCCKRBBISA-N.
| Molecular formula | C6H12ClF2N |
|---|---|
| Molecular weight | 171.61 g/mol |
| IUPAC name | (1S)-1-(3,3-difluorocyclobutyl)ethanamine;hydrochloride |
| InChIKey | XYOIKVIEECCBCN-WCCKRBBISA-N |
| SMILES | C[C@@H](C1CC(C1)(F)F)N.Cl |
Computed by PubChem (NCBI)