Products 2309463-53-2

CAS 2309463-53-2 is the registry number for Methyl 2-(acetylsulfanyl)-2-cyclopropylacetate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Methyl 2-acetylsulfanyl-2-cyclopropylacetate (CAS 2309463-53-2) is a chemical compound with the molecular formula C8H12O3S and a molecular weight of 188.25 g/mol. IUPAC name: methyl 2-acetylsulfanyl-2-cyclopropylacetate. InChIKey: DPCKNOXZDLRFGR-UHFFFAOYSA-N.

Identity
Molecular formulaC8H12O3S
Molecular weight188.25 g/mol
IUPAC namemethyl 2-acetylsulfanyl-2-cyclopropylacetate
InChIKeyDPCKNOXZDLRFGR-UHFFFAOYSA-N
SMILESCC(=O)SC(C1CC1)C(=O)OC

Computed by PubChem (NCBI)