Products 2310135-18-1
CAS 2310135-18-1 appears in our catalog under these names: N-deacetylated BMS-202, N-deacetylated BMS-202, 98.03%, N-deacetylated BMS-202, 98%, N1-((2-Methoxy-6-((2-methyl-[1,1'-biphenyl]-3-yl)methoxy)pyridin-3-yl)methyl)ethane-1,2-diamine, 98%. Offered by: TargetMol, MedChemExpress, Ambeed, Chemat, BLDpharm. Available pack sizes: 2mg, 5mg, 5 mg, 100 mg, 50 mg, 10 mg, 25 mg, 10mM/1mL.
N'-[[2-methoxy-6-[(2-methyl-3-phenylphenyl)methoxy]-3-pyridinyl]methyl]ethane-1,2-diamine (CAS 2310135-18-1) is a chemical compound with the molecular formula C23H27N3O2 and a molecular weight of 377.5 g/mol. IUPAC name: N'-[[2-methoxy-6-[(2-methyl-3-phenylphenyl)methoxy]-3-pyridinyl]methyl]ethane-1,2-diamine. InChIKey: IVGJGWNPAKJGGB-UHFFFAOYSA-N.
| Molecular formula | C23H27N3O2 |
|---|---|
| Molecular weight | 377.5 g/mol |
| IUPAC name | N'-[[2-methoxy-6-[(2-methyl-3-phenylphenyl)methoxy]-3-pyridinyl]methyl]ethane-1,2-diamine |
| InChIKey | IVGJGWNPAKJGGB-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC=C1C2=CC=CC=C2)COC3=NC(=C(C=C3)CNCCN)OC |
Computed by PubChem (NCBI)