Products 3056977-25-1
CAS 3056977-25-1 is the registry number for (R)-3-(1-Aminoethyl)-N,N-bis(4-methoxybenzyl)pyridin-2-amine, >95%, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 25g, 1g.
3-[(1R)-1-aminoethyl]-N,N-bis[(4-methoxyphenyl)methyl]pyridin-2-amine (CAS 3056977-25-1) is a chemical compound with the molecular formula C23H27N3O2 and a molecular weight of 377.5 g/mol. IUPAC name: 3-[(1R)-1-aminoethyl]-N,N-bis[(4-methoxyphenyl)methyl]pyridin-2-amine. InChIKey: ABYRASHWKORCHG-QGZVFWFLSA-N.
| Molecular formula | C23H27N3O2 |
|---|---|
| Molecular weight | 377.5 g/mol |
| IUPAC name | 3-[(1R)-1-aminoethyl]-N,N-bis[(4-methoxyphenyl)methyl]pyridin-2-amine |
| InChIKey | ABYRASHWKORCHG-QGZVFWFLSA-N |
| SMILES | C[C@H](C1=C(N=CC=C1)N(CC2=CC=C(C=C2)OC)CC3=CC=C(C=C3)OC)N |
Computed by PubChem (NCBI)