Products 2310293-81-1
CAS 2310293-81-1 is the registry number for Microtubule inhibitor 8. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-[[2-(1-benzofuran-2-yl)phenyl]methyl]-4H-pyrrolo[2,3-d][1,3]thiazole-5-carboxamide (CAS 2310293-81-1) is a chemical compound with the molecular formula C21H15N3O2S and a molecular weight of 373.4 g/mol. IUPAC name: N-[[2-(1-benzofuran-2-yl)phenyl]methyl]-4H-pyrrolo[2,3-d][1,3]thiazole-5-carboxamide. InChIKey: SZMUCYJJURIOGS-UHFFFAOYSA-N.
| Molecular formula | C21H15N3O2S |
|---|---|
| Molecular weight | 373.4 g/mol |
| IUPAC name | N-[[2-(1-benzofuran-2-yl)phenyl]methyl]-4H-pyrrolo[2,3-d][1,3]thiazole-5-carboxamide |
| InChIKey | SZMUCYJJURIOGS-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(O2)C3=CC=CC=C3CNC(=O)C4=CC5=C(N4)N=CS5 |
Computed by PubChem (NCBI)