CAS 319462-34-5 appears in our catalog under these names: Axitinib Acid, Axitinib Impurity 14. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
2-[[3-[(E)-2-pyridin-2-ylethenyl]-1H-indazol-6-yl]sulfanyl]benzoic acid (CAS 319462-34-5) is a chemical compound with the molecular formula C21H15N3O2S and a molecular weight of 373.4 g/mol. IUPAC name: 2-[[3-[(E)-2-pyridin-2-ylethenyl]-1H-indazol-6-yl]sulfanyl]benzoic acid. InChIKey: WYRJFXWWGDSVNU-DHZHZOJOSA-N.
| Molecular formula | C21H15N3O2S |
|---|---|
| Molecular weight | 373.4 g/mol |
| IUPAC name | 2-[[3-[(E)-2-pyridin-2-ylethenyl]-1H-indazol-6-yl]sulfanyl]benzoic acid |
| InChIKey | WYRJFXWWGDSVNU-DHZHZOJOSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)O)SC2=CC3=C(C=C2)C(=NN3)/C=C/C4=CC=CC=N4 |
Computed by PubChem (NCBI)