CAS 23131-04-6 is the registry number for 3,3'-Bi-p-anisidine. Offered by: TRC. Available pack sizes: 250mg, 50mg.
3-(5-amino-2-methoxyphenyl)-4-methoxyaniline (CAS 23131-04-6) is a chemical compound with the molecular formula C14H16N2O2 and a molecular weight of 244.29 g/mol. IUPAC name: 3-(5-amino-2-methoxyphenyl)-4-methoxyaniline. InChIKey: WUBUVVAKRKMKCG-UHFFFAOYSA-N.
| Molecular formula | C14H16N2O2 |
|---|---|
| Molecular weight | 244.29 g/mol |
| IUPAC name | 3-(5-amino-2-methoxyphenyl)-4-methoxyaniline |
| InChIKey | WUBUVVAKRKMKCG-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)N)C2=C(C=CC(=C2)N)OC |
Computed by PubChem (NCBI)