CAS 23141-61-9 appears in our catalog under these names: 6–Methyl–5–nitroquinoline, 6-Methyl-5-nitroquinoline 97%, 6-Methyl-5-nitroquinoline, 98%. Offered by: GLPBio, Ambeed, Fluorochem. Available pack sizes: 5g, 10g, 25g, 100g.
6-methyl-5-nitroquinoline (CAS 23141-61-9) is a chemical compound with the molecular formula C10H8N2O2 and a molecular weight of 188.18 g/mol. IUPAC name: 6-methyl-5-nitroquinoline. InChIKey: CENBTULRDDPOGR-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O2 |
|---|---|
| Molecular weight | 188.18 g/mol |
| IUPAC name | 6-methyl-5-nitroquinoline |
| InChIKey | CENBTULRDDPOGR-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(C=C1)N=CC=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)