CAS 231607-76-4 is the registry number for 3,6-Bis(trifluoromethyl)quinoxalin-2(1H)-one, 98%. Offered by: AmBeed. Available pack sizes: 5g, 1g.
3,6-bis(trifluoromethyl)-1H-quinoxalin-2-one (CAS 231607-76-4) is a chemical compound with the molecular formula C10H4F6N2O and a molecular weight of 282.14 g/mol. IUPAC name: 3,6-bis(trifluoromethyl)-1H-quinoxalin-2-one. InChIKey: PAZIEKBLRBWBRP-UHFFFAOYSA-N.
| Molecular formula | C10H4F6N2O |
|---|---|
| Molecular weight | 282.14 g/mol |
| IUPAC name | 3,6-bis(trifluoromethyl)-1H-quinoxalin-2-one |
| InChIKey | PAZIEKBLRBWBRP-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(F)(F)F)N=C(C(=O)N2)C(F)(F)F |
Computed by PubChem (NCBI)