CAS 231607-77-5 appears in our catalog under these names: 3,7-Bis(trifluoromethyl)quinoxalin-2(1H)-one, 97%, 3,7-Bis(trifluoromethyl)-1,2-dihydroquinoxalin-2-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 10g, 5g, 0,5g, 50mg.
3,7-bis(trifluoromethyl)-1H-quinoxalin-2-one (CAS 231607-77-5) is a chemical compound with the molecular formula C10H4F6N2O and a molecular weight of 282.14 g/mol. IUPAC name: 3,7-bis(trifluoromethyl)-1H-quinoxalin-2-one. InChIKey: QTULGPUFALWLQU-UHFFFAOYSA-N.
| Molecular formula | C10H4F6N2O |
|---|---|
| Molecular weight | 282.14 g/mol |
| IUPAC name | 3,7-bis(trifluoromethyl)-1H-quinoxalin-2-one |
| InChIKey | QTULGPUFALWLQU-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(F)(F)F)NC(=O)C(=N2)C(F)(F)F |
Computed by PubChem (NCBI)