Products 2320344-35-0
CAS 2320344-35-0 is the registry number for 4-(Methoxycarbonyl)-3-oxobicyclo[2.2.2]octane-1-carboxylic Acid, 95%+, 95%+. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
4-methoxycarbonyl-3-oxobicyclo[2.2.2]octane-1-carboxylic acid (CAS 2320344-35-0) is a chemical compound with the molecular formula C11H14O5 and a molecular weight of 226.23 g/mol. IUPAC name: 4-methoxycarbonyl-3-oxobicyclo[2.2.2]octane-1-carboxylic acid. InChIKey: NQIRZDLSDGQKON-UHFFFAOYSA-N.
| Molecular formula | C11H14O5 |
|---|---|
| Molecular weight | 226.23 g/mol |
| IUPAC name | 4-methoxycarbonyl-3-oxobicyclo[2.2.2]octane-1-carboxylic acid |
| InChIKey | NQIRZDLSDGQKON-UHFFFAOYSA-N |
| SMILES | COC(=O)C12CCC(CC1)(CC2=O)C(=O)O |
Computed by PubChem (NCBI)