CAS 23210-21-1 appears in our catalog under these names: 2-Chloro-n,n-diphenylpropanamide, 95%, 2-Chloro-N,N-diphenylpropanamide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 10000mg, 5000mg.
2-chloro-N,N-diphenylpropanamide (CAS 23210-21-1) is a chemical compound with the molecular formula C15H14ClNO and a molecular weight of 259.73 g/mol. IUPAC name: 2-chloro-N,N-diphenylpropanamide. InChIKey: BWNUNGKNWBDEHB-UHFFFAOYSA-N.
| Molecular formula | C15H14ClNO |
|---|---|
| Molecular weight | 259.73 g/mol |
| IUPAC name | 2-chloro-N,N-diphenylpropanamide |
| InChIKey | BWNUNGKNWBDEHB-UHFFFAOYSA-N |
| SMILES | CC(C(=O)N(C1=CC=CC=C1)C2=CC=CC=C2)Cl |
Computed by PubChem (NCBI)