Products 2322051-02-3

CAS 2322051-02-3 is the registry number for Cas9-IN-3, 99.64%. Offered by: MedChemExpress. Available pack sizes: 10mM/1mL, 50 mg, 10 mg, 25 mg, 5 mg.

Structural formula: {0} (CAS {1})

(4-methylpiperidin-1-yl)-(3-phenylphenyl)methanone (CAS 2322051-02-3) is a chemical compound with the molecular formula C19H21NO and a molecular weight of 279.4 g/mol. IUPAC name: (4-methylpiperidin-1-yl)-(3-phenylphenyl)methanone. InChIKey: AIJJMOSTONEFEE-UHFFFAOYSA-N.

Identity
Molecular formulaC19H21NO
Molecular weight279.4 g/mol
IUPAC name(4-methylpiperidin-1-yl)-(3-phenylphenyl)methanone
InChIKeyAIJJMOSTONEFEE-UHFFFAOYSA-N
SMILESCC1CCN(CC1)C(=O)C2=CC=CC(=C2)C3=CC=CC=C3

Computed by PubChem (NCBI)