Products 2324152-25-0
CAS 2324152-25-0 is the registry number for DC360. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[2-(4,4-dimethyl-1-propan-2-ylquinolin-6-yl)ethynyl]benzoic acid (CAS 2324152-25-0) is a chemical compound with the molecular formula C23H23NO2 and a molecular weight of 345.4 g/mol. IUPAC name: 4-[2-(4,4-dimethyl-1-propan-2-ylquinolin-6-yl)ethynyl]benzoic acid. InChIKey: HXWVRWZLWIKKOS-UHFFFAOYSA-N.
| Molecular formula | C23H23NO2 |
|---|---|
| Molecular weight | 345.4 g/mol |
| IUPAC name | 4-[2-(4,4-dimethyl-1-propan-2-ylquinolin-6-yl)ethynyl]benzoic acid |
| InChIKey | HXWVRWZLWIKKOS-UHFFFAOYSA-N |
| SMILES | CC(C)N1C=CC(C2=C1C=CC(=C2)C#CC3=CC=C(C=C3)C(=O)O)(C)C |
Computed by PubChem (NCBI)