Products 497060-13-6
CAS 497060-13-6 is the registry number for 2,6,6-trimethyl-1-(4-phenoxyphenyl)-5,6,7-trihydroindol-4-one. Offered by: Biosynth. Available pack sizes: 250mg.
2,6,6-trimethyl-1-(4-phenoxyphenyl)-5,7-dihydroindol-4-one (CAS 497060-13-6) is a chemical compound with the molecular formula C23H23NO2 and a molecular weight of 345.4 g/mol. IUPAC name: 2,6,6-trimethyl-1-(4-phenoxyphenyl)-5,7-dihydroindol-4-one. InChIKey: VKRABNJZLAOVDY-UHFFFAOYSA-N.
| Molecular formula | C23H23NO2 |
|---|---|
| Molecular weight | 345.4 g/mol |
| IUPAC name | 2,6,6-trimethyl-1-(4-phenoxyphenyl)-5,7-dihydroindol-4-one |
| InChIKey | VKRABNJZLAOVDY-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(N1C3=CC=C(C=C3)OC4=CC=CC=C4)CC(CC2=O)(C)C |
Computed by PubChem (NCBI)