CAS 23250-50-2 is the registry number for (S,S)-Lysinoalanine. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2S)-2-amino-6-[[(2S)-2-amino-2-carboxyethyl]amino]hexanoic acid (CAS 23250-50-2) is a chemical compound with the molecular formula C9H19N3O4 and a molecular weight of 233.27 g/mol. IUPAC name: (2S)-2-amino-6-[[(2S)-2-amino-2-carboxyethyl]amino]hexanoic acid. InChIKey: IMSOBGJSYSFTKG-BQBZGAKWSA-N.
| Molecular formula | C9H19N3O4 |
|---|---|
| Molecular weight | 233.27 g/mol |
| IUPAC name | (2S)-2-amino-6-[[(2S)-2-amino-2-carboxyethyl]amino]hexanoic acid |
| InChIKey | IMSOBGJSYSFTKG-BQBZGAKWSA-N |
| SMILES | C(CCNC[C@@H](C(=O)O)N)C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)