CAS 6665-19-6 is the registry number for Lysyl-serine. Offered by: MedChemExpress. Available pack sizes: Get quote.
Lys-Ser is a dipeptide formed from L-lysine and L-serine residues. It has a role as a metabolite.
Source: ChEBI
| Molecular formula | C9H19N3O4 |
|---|---|
| Molecular weight | 233.27 g/mol |
| IUPAC name | (2S)-2-[[(2S)-2,6-diaminohexanoyl]amino]-3-hydroxypropanoic acid |
| InChIKey | YSZNURNVYFUEHC-BQBZGAKWSA-N |
| SMILES | C(CCN)C[C@@H](C(=O)N[C@@H](CO)C(=O)O)N |
Computed by PubChem (NCBI)