Products 23257-56-9
CAS 23257-56-9 appears in our catalog under these names: Levophacetoperane Hydrochloride, Levophacetoperane (hydrochloride), 98.00%, Levophacetoperane (hydrochloride) (Standard). Offered by: TRC, Biosynth, MedChemExpress. Available pack sizes: 100mg, 10mg, 5mg, 25mg, 50mg, 10mM/1mL, 25 mg, 50 mg.
[(R)-phenyl-[(2R)-piperidin-2-yl]methyl] acetate;hydrochloride (CAS 23257-56-9) is a chemical compound with the molecular formula C14H20ClNO2 and a molecular weight of 269.77 g/mol. IUPAC name: [(R)-phenyl-[(2R)-piperidin-2-yl]methyl] acetate;hydrochloride. InChIKey: LDPSCUMJCVDWCB-DTPOWOMPSA-N.
| Molecular formula | C14H20ClNO2 |
|---|---|
| Molecular weight | 269.77 g/mol |
| IUPAC name | [(R)-phenyl-[(2R)-piperidin-2-yl]methyl] acetate;hydrochloride |
| InChIKey | LDPSCUMJCVDWCB-DTPOWOMPSA-N |
| SMILES | CC(=O)O[C@@H]([C@H]1CCCCN1)C2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)
Synonyms:
Lidepran hydrochloride, Levophacetoperane hydrochloride, Levophacetoperane (hydrochloride), Levofacetoperane hydrochloride, (R*,R*)-(-)-2-(alpha-Acetoxybenzyl)piperidinium chloride, (R)-phenyl[(2R)-piperidin-2-yl]methyl acetate hydrochloride, Levophacetoperane HCl, Levophacetoperan hydrochloride, Phenyl-(2-piperidyl)methyl acetate hydrochloride, alpha-Phenyl-2-piperidinemethanol acetate hydrochloride