Products 23261-20-3
CAS 23261-20-3 appears in our catalog under these names: Dulcitol Diepoxide, VAL-083, VAL–083, 1,2:5,6-Dianhydrogalactitol, VAL-083, 98.0%. Offered by: TRC, TargetMol, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 100mg, 10mg, 1mg, 5mg, 25mg, 50mg, 200mg, 1,5g.
(1S,2R)-1-[(2S)-oxiran-2-yl]-2-[(2R)-oxiran-2-yl]ethane-1,2-diol (CAS 23261-20-3) is a chemical compound with the molecular formula C6H10O4 and a molecular weight of 146.14 g/mol. IUPAC name: (1S,2R)-1-[(2S)-oxiran-2-yl]-2-[(2R)-oxiran-2-yl]ethane-1,2-diol. InChIKey: AAFJXZWCNVJTMK-GUCUJZIJSA-N.
| Molecular formula | C6H10O4 |
|---|---|
| Molecular weight | 146.14 g/mol |
| IUPAC name | (1S,2R)-1-[(2S)-oxiran-2-yl]-2-[(2R)-oxiran-2-yl]ethane-1,2-diol |
| InChIKey | AAFJXZWCNVJTMK-GUCUJZIJSA-N |
| SMILES | C1[C@@H](O1)[C@@H]([C@@H]([C@@H]2CO2)O)O |
Computed by PubChem (NCBI)