CAS 2326220-69-1 appears in our catalog under these names: (S)–GLPG0974, (S)-GLPG0974, 98.79%, 98.79%, (S)-GLPG0974, 98.79%, (S)-GLPG0974, 99%. Offered by: GLPBio, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 10mg, 25mg, 5mg, 25 mg, 10 mg, 5 mg.
4-[[(2S)-1-(1-benzothiophene-3-carbonyl)-2-methylazetidine-2-carbonyl]-[(3-chlorophenyl)methyl]amino]butanoic acid (CAS 2326220-69-1) is a chemical compound with the molecular formula C25H25ClN2O4S and a molecular weight of 485.0 g/mol. IUPAC name: 4-[[(2S)-1-(1-benzothiophene-3-carbonyl)-2-methylazetidine-2-carbonyl]-[(3-chlorophenyl)methyl]amino]butanoic acid. InChIKey: MPMKMQHJHDHPBE-VWLOTQADSA-N.
| Molecular formula | C25H25ClN2O4S |
|---|---|
| Molecular weight | 485.0 g/mol |
| IUPAC name | 4-[[(2S)-1-(1-benzothiophene-3-carbonyl)-2-methylazetidine-2-carbonyl]-[(3-chlorophenyl)methyl]amino]butanoic acid |
| InChIKey | MPMKMQHJHDHPBE-VWLOTQADSA-N |
| SMILES | C[C@]1(CCN1C(=O)C2=CSC3=CC=CC=C32)C(=O)N(CCCC(=O)O)CC4=CC(=CC=C4)Cl |
Computed by PubChem (NCBI)