Products 133276-52-5
CAS 133276-52-5 appears in our catalog under these names: (Iso)-Samixogrel/ 99%, iso-Samixogrel. Offered by: TargetMol, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 5 mg.
(Z)-6-[4-[2-[(4-chlorophenyl)sulfonylamino]ethyl]phenyl]-6-pyridin-3-ylhex-5-enoic acid (CAS 133276-52-5) is a chemical compound with the molecular formula C25H25ClN2O4S and a molecular weight of 485.0 g/mol. IUPAC name: (Z)-6-[4-[2-[(4-chlorophenyl)sulfonylamino]ethyl]phenyl]-6-pyridin-3-ylhex-5-enoic acid. InChIKey: LGHLGTHRJNIRCA-ZRJGMHBZSA-N.
| Molecular formula | C25H25ClN2O4S |
|---|---|
| Molecular weight | 485.0 g/mol |
| IUPAC name | (Z)-6-[4-[2-[(4-chlorophenyl)sulfonylamino]ethyl]phenyl]-6-pyridin-3-ylhex-5-enoic acid |
| InChIKey | LGHLGTHRJNIRCA-ZRJGMHBZSA-N |
| SMILES | C1=CC(=CN=C1)/C(=C\CCCC(=O)O)/C2=CC=C(C=C2)CCNS(=O)(=O)C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)
Synonyms:
(Iso)-Samixogrel, iso-Samixogrel