CAS 2326298-47-7 is the registry number for Telmisartan Impurity 42. Offered by: Chemat Brand. Available pack sizes: on request.
4-(1-aminobutylideneamino)-3-methylbenzoic acid (CAS 2326298-47-7) is a chemical compound with the molecular formula C12H16N2O2 and a molecular weight of 220.27 g/mol. IUPAC name: 4-(1-aminobutylideneamino)-3-methylbenzoic acid. InChIKey: IZZCURMPPZZQBR-UHFFFAOYSA-N.
| Molecular formula | C12H16N2O2 |
|---|---|
| Molecular weight | 220.27 g/mol |
| IUPAC name | 4-(1-aminobutylideneamino)-3-methylbenzoic acid |
| InChIKey | IZZCURMPPZZQBR-UHFFFAOYSA-N |
| SMILES | CCCC(=NC1=C(C=C(C=C1)C(=O)O)C)N |
Computed by PubChem (NCBI)