CAS 23282-55-5 appears in our catalog under these names: Sulfachloropyridazine sodium, 98%, Sulfachlorpyridazine Sodium, >95% (HPLC), Sodium N-(6-chloropyridazin-3-yl)sulphanilamidate, Sulfachloropyridazine sodium, 97%, Sulfachloropyridazine sodium 98%. Offered by: Combi-blocks, TRC, Biosynth, Thermo Scientific (Acros), Ambeed. Available pack sizes: 1kg, 100g, 25g, 500g, 5g, 100mg, 1g, 1000g.
Sodium (4-aminophenyl)sulfonyl-(6-chloropyridazin-3-yl)azanide (CAS 23282-55-5) is a chemical compound with the molecular formula C10H8ClN4NaO2S and a molecular weight of 306.70 g/mol. IUPAC name: sodium (4-aminophenyl)sulfonyl-(6-chloropyridazin-3-yl)azanide. InChIKey: ODWMXYHUKDMPTR-UHFFFAOYSA-N.
| Molecular formula | C10H8ClN4NaO2S |
|---|---|
| Molecular weight | 306.70 g/mol |
| IUPAC name | sodium (4-aminophenyl)sulfonyl-(6-chloropyridazin-3-yl)azanide |
| InChIKey | ODWMXYHUKDMPTR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N)S(=O)(=O)[N-]C2=NN=C(C=C2)Cl.[Na+] |
Computed by PubChem (NCBI)