CAS 71720-40-6 is the registry number for Sulfachloropyrazine sodium, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 25g, 5g, 1g.
Sodium (4-aminophenyl)sulfonyl-(5-chloropyrazin-2-yl)azanide (CAS 71720-40-6) is a chemical compound with the molecular formula C10H8ClN4NaO2S and a molecular weight of 306.70 g/mol. IUPAC name: sodium (4-aminophenyl)sulfonyl-(5-chloropyrazin-2-yl)azanide. InChIKey: XAGGLFSIKVVWCM-UHFFFAOYSA-N.
| Molecular formula | C10H8ClN4NaO2S |
|---|---|
| Molecular weight | 306.70 g/mol |
| IUPAC name | sodium (4-aminophenyl)sulfonyl-(5-chloropyrazin-2-yl)azanide |
| InChIKey | XAGGLFSIKVVWCM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N)S(=O)(=O)[N-]C2=CN=C(C=N2)Cl.[Na+] |
Computed by PubChem (NCBI)