Products 23291-98-7
CAS 23291-98-7 appears in our catalog under these names: 3-(2,3-Dihydro-1H-inden-5-yl)propanoic acid, 3-(2,3-dihydro-1H-inden-5-yl)propanoic acid, 95%. Offered by: Biosynth, Chemat. Available pack sizes: 0,5g, 50mg, 100mg, 250mg, 1g.
3-(2,3-dihydro-1H-inden-5-yl)propanoic acid (CAS 23291-98-7) is a chemical compound with the molecular formula C12H14O2 and a molecular weight of 190.24 g/mol. IUPAC name: 3-(2,3-dihydro-1H-inden-5-yl)propanoic acid. InChIKey: RYDLHBJFDFGPNP-UHFFFAOYSA-N.
| Molecular formula | C12H14O2 |
|---|---|
| Molecular weight | 190.24 g/mol |
| IUPAC name | 3-(2,3-dihydro-1H-inden-5-yl)propanoic acid |
| InChIKey | RYDLHBJFDFGPNP-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1)C=C(C=C2)CCC(=O)O |
Computed by PubChem (NCBI)