CAS 233-34-1 appears in our catalog under these names: 1H-Benzo[g]indole, 95%, 1H-Benzo[g]indole, 97%, 1H-Benzo[g]indole 97%, 1H-BENZO(G)INDOLE, 1H-Benz[g]indole, 97%. Offered by: Combi-blocks, Chemat Brand, Ambeed, Sigma-Aldrich, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 10g.
1H-benzo[g]indole (CAS 233-34-1) is a chemical compound with the molecular formula C12H9N and a molecular weight of 167.21 g/mol. IUPAC name: 1H-benzo[g]indole. InChIKey: HIYWOHBEPVGIQN-UHFFFAOYSA-N.
| Molecular formula | C12H9N |
|---|---|
| Molecular weight | 167.21 g/mol |
| IUPAC name | 1H-benzo[g]indole |
| InChIKey | HIYWOHBEPVGIQN-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC3=C2NC=C3 |
Computed by PubChem (NCBI)