Products 519-61-9
CAS 519-61-9 is the registry number for Pyrido(2,1,6-de)quinolizine. Offered by: TRC. Available pack sizes: 25mg.
13-azatricyclo[7.3.1.05,13]trideca-1(12),2,4,6,8,10-hexaene (CAS 519-61-9) is a chemical compound with the molecular formula C12H9N and a molecular weight of 167.21 g/mol. IUPAC name: 13-azatricyclo[7.3.1.05,13]trideca-1(12),2,4,6,8,10-hexaene. InChIKey: NYGOXVYQBYCRRU-UHFFFAOYSA-N.
| Molecular formula | C12H9N |
|---|---|
| Molecular weight | 167.21 g/mol |
| IUPAC name | 13-azatricyclo[7.3.1.05,13]trideca-1(12),2,4,6,8,10-hexaene |
| InChIKey | NYGOXVYQBYCRRU-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC=CC3=CC=CC(=C1)N23 |
Computed by PubChem (NCBI)