CAS 233-68-1 is the registry number for Naphtho[1,2-c][1,2,5]thiadiazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Benzo[g][2,1,3]benzothiadiazole (CAS 233-68-1) is a chemical compound with the molecular formula C10H6N2S and a molecular weight of 186.24 g/mol. IUPAC name: benzo[g][2,1,3]benzothiadiazole. InChIKey: OVUYEFLHMIBQIP-UHFFFAOYSA-N.
| Molecular formula | C10H6N2S |
|---|---|
| Molecular weight | 186.24 g/mol |
| IUPAC name | benzo[g][2,1,3]benzothiadiazole |
| InChIKey | OVUYEFLHMIBQIP-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC3=NSN=C32 |
Computed by PubChem (NCBI)