CAS 870065-06-8 is the registry number for 2-(Thiophen-3-yl)nicotinonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 10g, 1g, 5g.
2-thiophen-3-ylpyridine-3-carbonitrile (CAS 870065-06-8) is a chemical compound with the molecular formula C10H6N2S and a molecular weight of 186.24 g/mol. IUPAC name: 2-thiophen-3-ylpyridine-3-carbonitrile. InChIKey: DWILXKHBTORMMP-UHFFFAOYSA-N.
| Molecular formula | C10H6N2S |
|---|---|
| Molecular weight | 186.24 g/mol |
| IUPAC name | 2-thiophen-3-ylpyridine-3-carbonitrile |
| InChIKey | DWILXKHBTORMMP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)C2=CSC=C2)C#N |
Computed by PubChem (NCBI)