CAS 2331212-02-1 appears in our catalog under these names: ((1R,2R)-2-Aminocyclopentyl)methanol hydrochloride, 97%, ((1R,2R)-2-Aminocyclopentyl)methanol hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 250mg, 0,5g, 50mg.
[(1R,2R)-2-aminocyclopentyl]methanol;hydrochloride (CAS 2331212-02-1) is a chemical compound with the molecular formula C6H14ClNO and a molecular weight of 151.63 g/mol. IUPAC name: [(1R,2R)-2-aminocyclopentyl]methanol;hydrochloride. InChIKey: DJZSFZUZNGAAID-RIHPBJNCSA-N.
| Molecular formula | C6H14ClNO |
|---|---|
| Molecular weight | 151.63 g/mol |
| IUPAC name | [(1R,2R)-2-aminocyclopentyl]methanol;hydrochloride |
| InChIKey | DJZSFZUZNGAAID-RIHPBJNCSA-N |
| SMILES | C1C[C@H]([C@@H](C1)N)CO.Cl |
Computed by PubChem (NCBI)