Products 233775-36-5
CAS 233775-36-5 is the registry number for 6-Amino-1-isopropyl-3,4-dihydroquinolin-2(1H)-one, 97%. Offered by: Ambeed, BLDpharm. Available pack sizes: 100mg, 250mg, 1g.
6-amino-1-propan-2-yl-3,4-dihydroquinolin-2-one (CAS 233775-36-5) is a chemical compound with the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. IUPAC name: 6-amino-1-propan-2-yl-3,4-dihydroquinolin-2-one. InChIKey: AWCYCAKHUZWYHK-UHFFFAOYSA-N.
| Molecular formula | C12H16N2O |
|---|---|
| Molecular weight | 204.27 g/mol |
| IUPAC name | 6-amino-1-propan-2-yl-3,4-dihydroquinolin-2-one |
| InChIKey | AWCYCAKHUZWYHK-UHFFFAOYSA-N |
| SMILES | CC(C)N1C(=O)CCC2=C1C=CC(=C2)N |
Computed by PubChem (NCBI)