CAS 2338-25-2 appears in our catalog under these names: 5,6-Dichloro-2-(trifluoromethyl)-1h-benzimidazole, 95%, Fenazaflor Impurity 1. Offered by: Combi-blocks, Chemat Brand. Available pack sizes: 5g, 1g, on request.
5,6-dichloro-2-(trifluoromethyl)-1H-benzimidazole (CAS 2338-25-2) is a chemical compound with the molecular formula C8H3Cl2F3N2 and a molecular weight of 255.02 g/mol. IUPAC name: 5,6-dichloro-2-(trifluoromethyl)-1H-benzimidazole. InChIKey: KUMRUFFLHYXFLV-UHFFFAOYSA-N.
| Molecular formula | C8H3Cl2F3N2 |
|---|---|
| Molecular weight | 255.02 g/mol |
| IUPAC name | 5,6-dichloro-2-(trifluoromethyl)-1H-benzimidazole |
| InChIKey | KUMRUFFLHYXFLV-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CC(=C1Cl)Cl)N=C(N2)C(F)(F)F |
Computed by PubChem (NCBI)